C19H15F4N3O2 — CID 134291510
5-fluoro-2-(5-methoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291510) has the molecular formula C19H15F4N3O2 and a molecular weight of 393.34 g/mol. Its IUPAC name is 5-fluoro-2-(5-methoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-fluoro-2-(5-methoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291510 |
| Molecular Formula | C19H15F4N3O2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 5-fluoro-2-(5-methoxy-2-methylanilino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | COc1ccc(C)c(Nc2nc(=O)c(F)cn2Cc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H15F4N3O2/c1-10-3-4-12(28-2)7-16(10)24-19-25-18(27)15(22)9-26(19)8-11-5-13(20)17(23)14(21)6-11/h3-7,9H,8H2,1-2H3,(H,24,25,27) |
| InChIKey | OGYPTBWSACBKLL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|