C20H17F3N4O3 — CID 134290906
2-(4-methoxy-2-methylanilino)-4-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 134290906) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-(4-methoxy-2-methylanilino)-4-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-methoxy-2-methylanilino)-4-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134290906 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(4-methoxy-2-methylanilino)-4-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(Nc2nc(=O)c(C(N)=O)cn2Cc2cc(F)c(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-10-5-12(30-2)3-4-16(10)25-20-26-19(29)13(18(24)28)9-27(20)8-11-6-14(21)17(23)15(22)7-11/h3-7,9H,8H2,1-2H3,(H2,24,28)(H,25,26,29) |
| InChIKey | VFROCPSJBUUNOG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|