C19H15F3N4O4 — CID 134291787
3-(4-methoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid (PubChem CID 134291787) has the molecular formula C19H15F3N4O4 and a molecular weight of 420.35 g/mol. Its IUPAC name is 3-(4-methoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 3-(4-methoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 134291787 |
| Molecular Formula | C19H15F3N4O4 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-(4-methoxy-2-methylanilino)-5-oxo-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazine-6-carboxylic acid |
| SMILES | COc1ccc(Nc2nc(=O)c(C(=O)O)nn2Cc2cc(F)c(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C19H15F3N4O4/c1-9-5-11(30-2)3-4-14(9)23-19-24-17(27)16(18(28)29)25-26(19)8-10-6-12(20)15(22)13(21)7-10/h3-7H,8H2,1-2H3,(H,28,29)(H,23,24,27) |
| InChIKey | IQJZIMCDHGBXFP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|