C21H21F3N4O2 — CID 142332039
3-[5-(3-hydroxypropyl)-2-methylanilino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 142332039) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 3-[5-(3-hydroxypropyl)-2-methylanilino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-[5-(3-hydroxypropyl)-2-methylanilino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 142332039 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-[5-(3-hydroxypropyl)-2-methylanilino]-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | Cc1ccc(CCCO)cc1Nc1nc(=O)c(C)nn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-12-5-6-14(4-3-7-29)10-18(12)25-21-26-20(30)13(2)27-28(21)11-15-8-16(22)19(24)17(23)9-15/h5-6,8-10,29H,3-4,7,11H2,1-2H3,(H,25,26,30) |
| InChIKey | ZIHCNMRXHGZXKP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|