C18H14F4N4O2 — CID 134291709
2-[(2,5-dimethyl-6-oxo-1H-pyridin-3-yl)amino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291709) has the molecular formula C18H14F4N4O2 and a molecular weight of 394.33 g/mol. Its IUPAC name is 2-[(2,5-dimethyl-6-oxo-1H-pyridin-3-yl)amino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-[(2,5-dimethyl-6-oxo-1H-pyridin-3-yl)amino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291709 |
| Molecular Formula | C18H14F4N4O2 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[(2,5-dimethyl-6-oxo-1H-pyridin-3-yl)amino]-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | Cc1[nH]c(=O)c(C)cc1Nc1nc(=O)c(F)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H14F4N4O2/c1-8-3-14(9(2)23-16(8)27)24-18-25-17(28)13(21)7-26(18)6-10-4-11(19)15(22)12(20)5-10/h3-5,7H,6H2,1-2H3,(H,23,27)(H,24,25,28) |
| InChIKey | ZBGKTXPFYNLDQJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|