C12H9F4N3O — CID 145173824
5-fluoro-2-(methylamino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 145173824) has the molecular formula C12H9F4N3O and a molecular weight of 287.22 g/mol. Its IUPAC name is 5-fluoro-2-(methylamino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 5-fluoro-2-(methylamino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 145173824 |
| Molecular Formula | C12H9F4N3O |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-fluoro-2-(methylamino)-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | CNc1nc(=O)c(F)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H9F4N3O/c1-17-12-18-11(20)9(15)5-19(12)4-6-2-7(13)10(16)8(14)3-6/h2-3,5H,4H2,1H3,(H,17,18,20) |
| InChIKey | MLEAEXKUSBCHNC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|