C18H14ClF3N4O2 — CID 134291302
3-(4-chloro-5-methoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134291302) has the molecular formula C18H14ClF3N4O2 and a molecular weight of 410.78 g/mol. Its IUPAC name is 3-(4-chloro-5-methoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(4-chloro-5-methoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134291302 |
| Molecular Formula | C18H14ClF3N4O2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-(4-chloro-5-methoxy-2-methylanilino)-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(Nc2nc(=O)cnn2Cc2cc(F)c(F)c(F)c2)c(C)cc1Cl |
| InChI | InChI=1S/C18H14ClF3N4O2/c1-9-3-11(19)15(28-2)6-14(9)24-18-25-16(27)7-23-26(18)8-10-4-12(20)17(22)13(21)5-10/h3-7H,8H2,1-2H3,(H,24,25,27) |
| InChIKey | MDASGAXJFMQIBO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|