C18H17F2N5O3 — CID 142332058
2-[(2,6-difluoro-4-pyridinyl)methyl]-3-(4,5-dimethoxy-2-methylanilino)-1,2,4-triazin-5-one (PubChem CID 142332058) has the molecular formula C18H17F2N5O3 and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-pyridinyl)methyl]-3-(4,5-dimethoxy-2-methylanilino)-1,2,4-triazin-5-one.
| Compound Name | 2-[(2,6-difluoro-4-pyridinyl)methyl]-3-(4,5-dimethoxy-2-methylanilino)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 142332058 |
| Molecular Formula | C18H17F2N5O3 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[(2,6-difluoro-4-pyridinyl)methyl]-3-(4,5-dimethoxy-2-methylanilino)-1,2,4-triazin-5-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)cnn2Cc2cc(F)nc(F)c2)cc1OC |
| InChI | InChI=1S/C18H17F2N5O3/c1-10-4-13(27-2)14(28-3)7-12(10)22-18-24-17(26)8-21-25(18)9-11-5-15(19)23-16(20)6-11/h4-8H,9H2,1-3H3,(H,22,24,26) |
| InChIKey | QLHVEACNVHBOSR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|