C18H16ClF3N4O2 — CID 134291608
3-(5-chloro-4-methoxy-2-methylanilino)-2-[(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)methyl]-1,2,4-triazin-5-one (PubChem CID 134291608) has the molecular formula C18H16ClF3N4O2 and a molecular weight of 412.80 g/mol. Its IUPAC name is 3-(5-chloro-4-methoxy-2-methylanilino)-2-[(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-(5-chloro-4-methoxy-2-methylanilino)-2-[(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134291608 |
| Molecular Formula | C18H16ClF3N4O2 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 3-(5-chloro-4-methoxy-2-methylanilino)-2-[(3,4,5-trifluorocyclohexa-1,3-dien-1-yl)methyl]-1,2,4-triazin-5-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)cnn2CC2=CC(F)=C(F)C(F)C2)cc1Cl |
| InChI | InChI=1S/C18H16ClF3N4O2/c1-9-3-15(28-2)11(19)6-14(9)24-18-25-16(27)7-23-26(18)8-10-4-12(20)17(22)13(21)5-10/h3-4,6-7,13H,5,8H2,1-2H3,(H,24,25,27) |
| InChIKey | JHNUAGZGGQKUQD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |