C11H8F3N3OS — CID 134290846
3-methylsulfanyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 134290846) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is 3-methylsulfanyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-methylsulfanyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 134290846 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-methylsulfanyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | CSc1nc(=O)cnn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H8F3N3OS/c1-19-11-16-9(18)4-15-17(11)5-6-2-7(12)10(14)8(13)3-6/h2-4H,5H2,1H3 |
| InChIKey | WWRSETSEOSASOO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|