C11H9F3N4O — CID 142331988
3-amino-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one (PubChem CID 142331988) has the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. Its IUPAC name is 3-amino-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one.
| Compound Name | 3-amino-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 142331988 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-amino-6-methyl-2-[(3,4,5-trifluorophenyl)methyl]-1,2,4-triazin-5-one |
| SMILES | Cc1nn(Cc2cc(F)c(F)c(F)c2)c(N)nc1=O |
| InChI | InChI=1S/C11H9F3N4O/c1-5-10(19)16-11(15)18(17-5)4-6-2-7(12)9(14)8(13)3-6/h2-3H,4H2,1H3,(H2,15,16,19) |
| InChIKey | MYADLHDGQOISKL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|