C15H12BrNO5 — CID 1342916
2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]benzaldehyde (PubChem CID 1342916) has the molecular formula C15H12BrNO5 and a molecular weight of 366.17 g/mol. Its IUPAC name is 2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]benzaldehyde.
| Compound Name | 2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 1342916 |
| Molecular Formula | C15H12BrNO5 |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]benzaldehyde |
| SMILES | COc1cc(C=O)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12BrNO5/c1-21-14-6-11(8-18)13(16)7-15(14)22-9-10-2-4-12(5-3-10)17(19)20/h2-8H,9H2,1H3 |
| InChIKey | JMRWZNXBNCLLRP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|