C21H27BrN2O5 — CID 66534611
N-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 66534611) has the molecular formula C21H27BrN2O5 and a molecular weight of 467.36 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66534611 |
| Molecular Formula | C21H27BrN2O5 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | COc1cc(CNCCCOC(C)C)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H27BrN2O5/c1-15(2)28-10-4-9-23-13-17-11-20(27-3)21(12-19(17)22)29-14-16-5-7-18(8-6-16)24(25)26/h5-8,11-12,15,23H,4,9-10,13-14H2,1-3H3 |
| InChIKey | LCCHMHZHAQXZDO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|