C21H27BrN2O4 — CID 66533042
N-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine (PubChem CID 66533042) has the molecular formula C21H27BrN2O4 and a molecular weight of 451.36 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 66533042 |
| Molecular Formula | C21H27BrN2O4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
| SMILES | CCOc1cc(CNCCC(C)C)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H27BrN2O4/c1-4-27-20-11-17(13-23-10-9-15(2)3)19(22)12-21(20)28-14-16-5-7-18(8-6-16)24(25)26/h5-8,11-12,15,23H,4,9-10,13-14H2,1-3H3 |
| InChIKey | OKROWSBYVWRXPW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|