C20H26BrN3O4 — CID 66537944
N'-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 66537944) has the molecular formula C20H26BrN3O4 and a molecular weight of 452.35 g/mol. Its IUPAC name is N'-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66537944 |
| Molecular Formula | C20H26BrN3O4 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | N'-[[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CCOc1cc(CNCCCNC)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H26BrN3O4/c1-3-27-19-11-16(13-23-10-4-9-22-2)18(21)12-20(19)28-14-15-5-7-17(8-6-15)24(25)26/h5-8,11-12,22-23H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | PILVBLHOOFFANC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|