C54H42N4 — CID 134292587
4-pyridin-4-yl-2,6-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 134292587) has the molecular formula C54H42N4 and a molecular weight of 746.96 g/mol. Its IUPAC name is 4-pyridin-4-yl-2,6-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-pyridin-4-yl-2,6-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 134292587 |
| Molecular Formula | C54H42N4 |
| Molecular Weight | 746.96 g/mol |
| Exact Mass | 746.34 |
| IUPAC Name | 4-pyridin-4-yl-2,6-bis[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2cc(-c3ccncc3)cc(-n3c4ccccc4c4cc(-c5c(C)cc(C)cc5C)ccc43)c2C#N)c(C)c1 |
| InChI | InChI=1S/C54H42N4/c1-32-23-34(3)53(35(4)24-32)39-15-17-49-44(27-39)42-11-7-9-13-47(42)57(49)51-29-41(38-19-21-56-22-20-38)30-52(46(51)31-55)58-48-14-10-8-12-43(48)45-28-40(16-18-50(45)58)54-36(5)25-33(2)26-37(54)6/h7-30H,1-6H3 |
| InChIKey | VQLPWMNYDIYVJR-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.96 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |