C73H61F2N3 — CID 148504830
2,6-bis[2,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(2,6-difluorophenyl)benzonitrile (PubChem CID 148504830) has the molecular formula C73H61F2N3 and a molecular weight of 1018.31 g/mol. Its IUPAC name is 2,6-bis[2,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(2,6-difluorophenyl)benzonitrile.
| Compound Name | 2,6-bis[2,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(2,6-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 148504830 |
| Molecular Formula | C73H61F2N3 |
| Molecular Weight | 1018.31 g/mol |
| Exact Mass | 1017.48 |
| IUPAC Name | 2,6-bis[2,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-4-(2,6-difluorophenyl)benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccc(-c4c(C)cc(C)cc4C)cc2n3-c2cc(-c3c(F)cccc3F)cc(-n3c4ccc(-c5c(C)cc(C)cc5C)cc4c4ccc(-c5c(C)cc(C)cc5C)cc43)c2C#N)c(C)c1 |
| InChI | InChI=1S/C73H61F2N3/c1-39-24-43(5)69(44(6)25-39)51-18-22-63-58(32-51)56-20-16-53(71-47(9)28-41(3)29-48(71)10)34-65(56)77(63)67-36-55(73-61(74)14-13-15-62(73)75)37-68(60(67)38-76)78-64-23-19-52(70-45(7)26-40(2)27-46(70)8)33-59(64)57-21-17-54(35-66(57)78)72-49(11)30-42(4)31-50(72)12/h13-37H,1-12H3 |
| InChIKey | MLJCUCWLJORQSV-UHFFFAOYSA-N |
| XLogP | 20.07 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.31 |
| LogP ≤ 5 | 20.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |