C51H33F2N3 — CID 142489544
4-(3,5-difluorophenyl)-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 142489544) has the molecular formula C51H33F2N3 and a molecular weight of 725.84 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 4-(3,5-difluorophenyl)-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 142489544 |
| Molecular Formula | C51H33F2N3 |
| Molecular Weight | 725.84 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | 4-(3,5-difluorophenyl)-2,6-bis[2-(4-methylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c4ccccc4n(-c4cc(-c5cc(F)cc(F)c5)cc(-n5c6ccccc6c6ccc(-c7ccc(C)cc7)cc65)c4C#N)c3c2)cc1 |
| InChI | InChI=1S/C51H33F2N3/c1-31-11-15-33(16-12-31)35-19-21-43-41-7-3-5-9-46(41)55(48(43)25-35)50-27-38(37-23-39(52)29-40(53)24-37)28-51(45(50)30-54)56-47-10-6-4-8-42(47)44-22-20-36(26-49(44)56)34-17-13-32(2)14-18-34/h3-29H,1-2H3 |
| InChIKey | KWLYKZUSKOIGOH-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.84 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |