C51H27F2N5 — CID 154959862
2,6-bis[2-(2-cyanophenyl)carbazol-9-yl]-4-(3,5-difluorophenyl)benzonitrile (PubChem CID 154959862) has the molecular formula C51H27F2N5 and a molecular weight of 747.81 g/mol. Its IUPAC name is 2,6-bis[2-(2-cyanophenyl)carbazol-9-yl]-4-(3,5-difluorophenyl)benzonitrile.
| Compound Name | 2,6-bis[2-(2-cyanophenyl)carbazol-9-yl]-4-(3,5-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 154959862 |
| Molecular Formula | C51H27F2N5 |
| Molecular Weight | 747.81 g/mol |
| Exact Mass | 747.22 |
| IUPAC Name | 2,6-bis[2-(2-cyanophenyl)carbazol-9-yl]-4-(3,5-difluorophenyl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc2c3ccccc3n(-c3cc(-c4cc(F)cc(F)c4)cc(-n4c5ccccc5c5ccc(-c6ccccc6C#N)cc54)c3C#N)c2c1 |
| InChI | InChI=1S/C51H27F2N5/c52-37-21-35(22-38(53)27-37)36-25-50(57-46-15-7-5-13-41(46)43-19-17-31(23-48(43)57)39-11-3-1-9-33(39)28-54)45(30-56)51(26-36)58-47-16-8-6-14-42(47)44-20-18-32(24-49(44)58)40-12-4-2-10-34(40)29-55/h1-27H |
| InChIKey | RHUVZRLEVBUMDG-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.81 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |