C20H21ClN4O — CID 134293404
1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]-3-cyclopropylphenyl]-1-methylhydrazine (PubChem CID 134293404) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]-3-cyclopropylphenyl]-1-methylhydrazine.
| Compound Name | 1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]-3-cyclopropylphenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 134293404 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]-3-cyclopropylphenyl]-1-methylhydrazine |
| SMILES | CN(N)c1cccc(C2CC2)c1COc1ccn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H21ClN4O/c1-24(22)19-4-2-3-17(14-5-6-14)18(19)13-26-20-11-12-25(23-20)16-9-7-15(21)8-10-16/h2-4,7-12,14H,5-6,13,22H2,1H3 |
| InChIKey | UOBDDVMKXUSPMX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|