C44H62N4O4 — CID 134295466
2-ethyl-N-[5-[(3E)-3-[6-(2-ethylhexanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]hexanamide (PubChem CID 134295466) has the molecular formula C44H62N4O4 and a molecular weight of 711.00 g/mol. Its IUPAC name is 2-ethyl-N-[5-[(3E)-3-[6-(2-ethylhexanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]hexanamide.
| Compound Name | 2-ethyl-N-[5-[(3E)-3-[6-(2-ethylhexanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]hexanamide |
|---|---|
| PubChem CID | 134295466 |
| Molecular Formula | C44H62N4O4 |
| Molecular Weight | 711.00 g/mol |
| Exact Mass | 710.48 |
| IUPAC Name | 2-ethyl-N-[5-[(3E)-3-[6-(2-ethylhexanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]hexanamide |
| SMILES | CCCCC(CC)C(=O)/N=C1\C=C2C(=C\C1=C1/C(=O)C(c3cc4c(cc3NC(=O)C(CC)CCCC)N(C)C(C)C4(C)C)=C1O)C(C)(C)C(C)N2C |
| InChI | InChI=1S/C44H62N4O4/c1-13-17-19-27(15-3)41(51)45-33-23-35-31(43(7,8)25(5)47(35)11)21-29(33)37-39(49)38(40(37)50)30-22-32-36(48(12)26(6)44(32,9)10)24-34(30)46-42(52)28(16-4)20-18-14-2/h21-28,49H,13-20H2,1-12H3,(H,45,51)/b38-30+,46-34+ |
| InChIKey | YOUHHWVHTQLHDL-MQELMRHGSA-N |
| XLogP | 9.47 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.00 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|