C13H23FN2O — CID 134295927
(E)-N-tert-butyl-4-(3-fluoro-3-methylpyrrolidin-1-yl)but-2-enamide (PubChem CID 134295927) has the molecular formula C13H23FN2O and a molecular weight of 242.34 g/mol. Its IUPAC name is (E)-N-tert-butyl-4-(3-fluoro-3-methylpyrrolidin-1-yl)but-2-enamide.
| Compound Name | (E)-N-tert-butyl-4-(3-fluoro-3-methylpyrrolidin-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 134295927 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (E)-N-tert-butyl-4-(3-fluoro-3-methylpyrrolidin-1-yl)but-2-enamide |
| SMILES | CC1(F)CCN(C/C=C/C(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23FN2O/c1-12(2,3)15-11(17)6-5-8-16-9-7-13(4,14)10-16/h5-6H,7-10H2,1-4H3,(H,15,17)/b6-5+ |
| InChIKey | RTIOPBQBPJOIIA-AATRIKPKSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|