C12H22F2N2O — CID 162375538
(E)-N-butan-2-yl-4-(3,3-difluoropyrrolidin-1-yl)but-2-enamide;molecular hydrogen (PubChem CID 162375538) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is (E)-N-butan-2-yl-4-(3,3-difluoropyrrolidin-1-yl)but-2-enamide;molecular hydrogen.
| Compound Name | (E)-N-butan-2-yl-4-(3,3-difluoropyrrolidin-1-yl)but-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 162375538 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (E)-N-butan-2-yl-4-(3,3-difluoropyrrolidin-1-yl)but-2-enamide;molecular hydrogen |
| SMILES | CCC(C)NC(=O)/C=C/CN1CCC(F)(F)C1.[H][H] |
| InChI | InChI=1S/C12H20F2N2O.H2/c1-3-10(2)15-11(17)5-4-7-16-8-6-12(13,14)9-16;/h4-5,10H,3,6-9H2,1-2H3,(H,15,17);1H/b5-4+; |
| InChIKey | DTYRVVPINZCHGI-FXRZFVDSSA-N |
| XLogP | 2.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|