C80H62N4 — CID 134302040
4,5-bis[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenyl-4-pyridinyl)benzonitrile (PubChem CID 134302040) has the molecular formula C80H62N4 and a molecular weight of 1079.40 g/mol. Its IUPAC name is 4,5-bis[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenyl-4-pyridinyl)benzonitrile.
| Compound Name | 4,5-bis[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenyl-4-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 134302040 |
| Molecular Formula | C80H62N4 |
| Molecular Weight | 1079.40 g/mol |
| Exact Mass | 1078.50 |
| IUPAC Name | 4,5-bis[3,6-bis(2,4-dimethylphenyl)carbazol-9-yl]-2-(2,6-diphenyl-4-pyridinyl)benzonitrile |
| SMILES | Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(C)cc4C)ccc2n3-c2cc(C#N)c(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc2-n2c3ccc(-c4ccc(C)cc4C)cc3c3cc(-c4ccc(C)cc4C)ccc32)c(C)c1 |
| InChI | InChI=1S/C80H62N4/c1-48-19-27-64(52(5)35-48)58-23-31-75-69(39-58)70-40-59(65-28-20-49(2)36-53(65)6)24-32-76(70)83(75)79-45-63(47-81)68(62-43-73(56-15-11-9-12-16-56)82-74(44-62)57-17-13-10-14-18-57)46-80(79)84-77-33-25-60(66-29-21-50(3)37-54(66)7)41-71(77)72-42-61(26-34-78(72)84)67-30-22-51(4)38-55(67)8/h9-46H,1-8H3 |
| InChIKey | PVSBVVCWJZTODP-UHFFFAOYSA-N |
| XLogP | 21.28 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.40 |
| LogP ≤ 5 | 21.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |