C26H23N3O3 — CID 134303940
2-[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]-2-phenylacetic acid (PubChem CID 134303940) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]-2-phenylacetic acid.
| Compound Name | 2-[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 134303940 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]-2-phenylacetic acid |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(C(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c27-15-23(25(30)29-22-11-10-21-16-28-13-12-20(21)14-22)17-6-8-19(9-7-17)24(26(31)32)18-4-2-1-3-5-18/h1-14,16,23-24H,15,27H2,(H,29,30)(H,31,32) |
| InChIKey | ATLDFHLGTJYIOS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |