C8H11NO — CID 13430690
(1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 13430690) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 13430690 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C8H11NO/c9-8(10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2,(H2,9,10)/t5-,6+,7-/m1/s1 |
| InChIKey | ZTUUVDYQBLRAAC-DSYKOEDSSA-N |
| XLogP | 0.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|