C16H23IN2O2S — CID 134308181
6-amino-2-(N-butanethioyl-2-iodoanilino)hexanoic acid (PubChem CID 134308181) has the molecular formula C16H23IN2O2S and a molecular weight of 434.34 g/mol. Its IUPAC name is 6-amino-2-(N-butanethioyl-2-iodoanilino)hexanoic acid.
| Compound Name | 6-amino-2-(N-butanethioyl-2-iodoanilino)hexanoic acid |
|---|---|
| PubChem CID | 134308181 |
| Molecular Formula | C16H23IN2O2S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 6-amino-2-(N-butanethioyl-2-iodoanilino)hexanoic acid |
| SMILES | CCCC(=S)N(c1ccccc1I)C(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H23IN2O2S/c1-2-7-15(22)19(13-9-4-3-8-12(13)17)14(16(20)21)10-5-6-11-18/h3-4,8-9,14H,2,5-7,10-11,18H2,1H3,(H,20,21) |
| InChIKey | HURADLLWLGQYSN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|