C17H25N3O4 — CID 174455659
2-[2-acetyl-N-(2-aminopropanoyl)anilino]-6-aminohexanoic acid (PubChem CID 174455659) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[2-acetyl-N-(2-aminopropanoyl)anilino]-6-aminohexanoic acid.
| Compound Name | 2-[2-acetyl-N-(2-aminopropanoyl)anilino]-6-aminohexanoic acid |
|---|---|
| PubChem CID | 174455659 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[2-acetyl-N-(2-aminopropanoyl)anilino]-6-aminohexanoic acid |
| SMILES | CC(=O)c1ccccc1N(C(=O)C(C)N)C(CCCCN)C(=O)O |
| InChI | InChI=1S/C17H25N3O4/c1-11(19)16(22)20(15(17(23)24)9-5-6-10-18)14-8-4-3-7-13(14)12(2)21/h3-4,7-8,11,15H,5-6,9-10,18-19H2,1-2H3,(H,23,24) |
| InChIKey | YNCIGVSRZWMZMT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|