C23H17IO4S2 — CID 134308553
dibenzyl 5-iodo-2-methylthieno[2,3-b]thiophene-3,4-dicarboxylate (PubChem CID 134308553) has the molecular formula C23H17IO4S2 and a molecular weight of 548.42 g/mol. Its IUPAC name is dibenzyl 5-iodo-2-methylthieno[2,3-b]thiophene-3,4-dicarboxylate.
| Compound Name | dibenzyl 5-iodo-2-methylthieno[2,3-b]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134308553 |
| Molecular Formula | C23H17IO4S2 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 547.96 |
| IUPAC Name | dibenzyl 5-iodo-2-methylthieno[2,3-b]thiophene-3,4-dicarboxylate |
| SMILES | Cc1sc2sc(I)c(C(=O)OCc3ccccc3)c2c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H17IO4S2/c1-14-17(21(25)27-12-15-8-4-2-5-9-15)18-19(20(24)30-23(18)29-14)22(26)28-13-16-10-6-3-7-11-16/h2-11H,12-13H2,1H3 |
| InChIKey | TVNINCOCNBHHND-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|