C16H14O2 — CID 134309953
1-(4-methylphenyl)-6-prop-2-ynoxyhexa-1,4-diyn-3-ol (PubChem CID 134309953) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(4-methylphenyl)-6-prop-2-ynoxyhexa-1,4-diyn-3-ol.
| Compound Name | 1-(4-methylphenyl)-6-prop-2-ynoxyhexa-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 134309953 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-(4-methylphenyl)-6-prop-2-ynoxyhexa-1,4-diyn-3-ol |
| SMILES | C#CCOCC#CC(O)C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C16H14O2/c1-3-12-18-13-4-5-16(17)11-10-15-8-6-14(2)7-9-15/h1,6-9,16-17H,12-13H2,2H3 |
| InChIKey | IJKUMPJMRLLZQT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|