C15H16N6 — CID 134310587
6-(4-pyridin-2-ylpiperazin-1-yl)imidazo[1,2-b]pyridazine (PubChem CID 134310587) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 6-(4-pyridin-2-ylpiperazin-1-yl)imidazo[1,2-b]pyridazine.
| Compound Name | 6-(4-pyridin-2-ylpiperazin-1-yl)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 134310587 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 6-(4-pyridin-2-ylpiperazin-1-yl)imidazo[1,2-b]pyridazine |
| SMILES | c1ccc(N2CCN(c3ccc4nccn4n3)CC2)nc1 |
| InChI | InChI=1S/C15H16N6/c1-2-6-16-13(3-1)19-9-11-20(12-10-19)15-5-4-14-17-7-8-21(14)18-15/h1-8H,9-12H2 |
| InChIKey | GHNMCOXPFXPMHI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |