C15H21N5O — CID 171690270
4-(1-imidazo[1,2-b]pyridazin-6-ylpiperidin-4-yl)morpholine (PubChem CID 171690270) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-(1-imidazo[1,2-b]pyridazin-6-ylpiperidin-4-yl)morpholine.
| Compound Name | 4-(1-imidazo[1,2-b]pyridazin-6-ylpiperidin-4-yl)morpholine |
|---|---|
| PubChem CID | 171690270 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-(1-imidazo[1,2-b]pyridazin-6-ylpiperidin-4-yl)morpholine |
| SMILES | c1cn2nc(N3CCC(N4CCOCC4)CC3)ccc2n1 |
| InChI | InChI=1S/C15H21N5O/c1-2-15(17-20-8-5-16-14(1)20)19-6-3-13(4-7-19)18-9-11-21-12-10-18/h1-2,5,8,13H,3-4,6-7,9-12H2 |
| InChIKey | GKOXSTZHSXLMJB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |