C22H20FN3O2 — CID 134311143
4-(4-fluoro-2-methoxy-5-methylphenyl)-2-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-1-one (PubChem CID 134311143) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-(4-fluoro-2-methoxy-5-methylphenyl)-2-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-1-one.
| Compound Name | 4-(4-fluoro-2-methoxy-5-methylphenyl)-2-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 134311143 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-(4-fluoro-2-methoxy-5-methylphenyl)-2-methyl-6-(1-methylpyrazol-4-yl)isoquinolin-1-one |
| SMILES | COc1cc(F)c(C)cc1-c1cn(C)c(=O)c2ccc(-c3cnn(C)c3)cc12 |
| InChI | InChI=1S/C22H20FN3O2/c1-13-7-18(21(28-4)9-20(13)23)19-12-25(2)22(27)16-6-5-14(8-17(16)19)15-10-24-26(3)11-15/h5-12H,1-4H3 |
| InChIKey | RHOZRSLZMPPWIL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |