C24H25N3O4S — CID 146546210
1-[4-ethoxy-3-[2-methyl-6-(1-methylpyrazol-4-yl)-1-oxoisoquinolin-4-yl]phenyl]ethanesulfinic acid (PubChem CID 146546210) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-[4-ethoxy-3-[2-methyl-6-(1-methylpyrazol-4-yl)-1-oxoisoquinolin-4-yl]phenyl]ethanesulfinic acid.
| Compound Name | 1-[4-ethoxy-3-[2-methyl-6-(1-methylpyrazol-4-yl)-1-oxoisoquinolin-4-yl]phenyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 146546210 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-[4-ethoxy-3-[2-methyl-6-(1-methylpyrazol-4-yl)-1-oxoisoquinolin-4-yl]phenyl]ethanesulfinic acid |
| SMILES | CCOc1ccc(C(C)S(=O)O)cc1-c1cn(C)c(=O)c2ccc(-c3cnn(C)c3)cc12 |
| InChI | InChI=1S/C24H25N3O4S/c1-5-31-23-9-7-16(15(2)32(29)30)10-21(23)22-14-26(3)24(28)19-8-6-17(11-20(19)22)18-12-25-27(4)13-18/h6-15H,5H2,1-4H3,(H,29,30) |
| InChIKey | PTIUCZKQFSYLPD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|