C20H22FN3O3 — CID 134312560
N-cyclohexyl-8-[(2-fluoro-4-pyridinyl)methyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-6-carboxamide (PubChem CID 134312560) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-cyclohexyl-8-[(2-fluoro-4-pyridinyl)methyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-6-carboxamide.
| Compound Name | N-cyclohexyl-8-[(2-fluoro-4-pyridinyl)methyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134312560 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-cyclohexyl-8-[(2-fluoro-4-pyridinyl)methyl]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-6-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(Cc2ccnc(F)c2)c2c(n1)OCCO2 |
| InChI | InChI=1S/C20H22FN3O3/c21-17-11-13(6-7-22-17)10-14-12-16(24-20-18(14)26-8-9-27-20)19(25)23-15-4-2-1-3-5-15/h6-7,11-12,15H,1-5,8-10H2,(H,23,25) |
| InChIKey | COXSDPHHCTUBBJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|