C3H6I2N2O — CID 134313626
2-amino-N,N-diiodopropanamide (PubChem CID 134313626) has the molecular formula C3H6I2N2O and a molecular weight of 339.90 g/mol. Its IUPAC name is 2-amino-N,N-diiodopropanamide.
| Compound Name | 2-amino-N,N-diiodopropanamide |
|---|---|
| PubChem CID | 134313626 |
| Molecular Formula | C3H6I2N2O |
| Molecular Weight | 339.90 g/mol |
| Exact Mass | 339.86 |
| IUPAC Name | 2-amino-N,N-diiodopropanamide |
| SMILES | CC(N)C(=O)N(I)I |
| InChI | InChI=1S/C3H6I2N2O/c1-2(6)3(8)7(4)5/h2H,6H2,1H3 |
| InChIKey | GKKAWESPGJLUSS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.90 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|