C7H16N3O5P — CID 87262460
[bis[(2S)-2-aminopropanoyl]amino]methylphosphonic acid (PubChem CID 87262460) has the molecular formula C7H16N3O5P and a molecular weight of 253.19 g/mol. Its IUPAC name is [bis[(2S)-2-aminopropanoyl]amino]methylphosphonic acid.
| Compound Name | [bis[(2S)-2-aminopropanoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87262460 |
| Molecular Formula | C7H16N3O5P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | [bis[(2S)-2-aminopropanoyl]amino]methylphosphonic acid |
| SMILES | C[C@H](N)C(=O)N(CP(=O)(O)O)C(=O)[C@H](C)N |
| InChI | InChI=1S/C7H16N3O5P/c1-4(8)6(11)10(3-16(13,14)15)7(12)5(2)9/h4-5H,3,8-9H2,1-2H3,(H2,13,14,15)/t4-,5-/m0/s1 |
| InChIKey | JENHJKMLIUMLDO-WHFBIAKZSA-N |
| XLogP | -1.83 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|