C30H30N2O4 — CID 134314609
(E)-5-anilino-4-hydroxy-1-[(2R)-2-[(1R)-1-hydroxy-2,2-diphenylethyl]pyrrolidin-1-yl]-2-methylidenepent-4-ene-1,3-dione (PubChem CID 134314609) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (E)-5-anilino-4-hydroxy-1-[(2R)-2-[(1R)-1-hydroxy-2,2-diphenylethyl]pyrrolidin-1-yl]-2-methylidenepent-4-ene-1,3-dione.
| Compound Name | (E)-5-anilino-4-hydroxy-1-[(2R)-2-[(1R)-1-hydroxy-2,2-diphenylethyl]pyrrolidin-1-yl]-2-methylidenepent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 134314609 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (E)-5-anilino-4-hydroxy-1-[(2R)-2-[(1R)-1-hydroxy-2,2-diphenylethyl]pyrrolidin-1-yl]-2-methylidenepent-4-ene-1,3-dione |
| SMILES | C=C(C(=O)/C(O)=C\Nc1ccccc1)C(=O)N1CCC[C@@H]1[C@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O4/c1-21(28(34)26(33)20-31-24-16-9-4-10-17-24)30(36)32-19-11-18-25(32)29(35)27(22-12-5-2-6-13-22)23-14-7-3-8-15-23/h2-10,12-17,20,25,27,29,31,33,35H,1,11,18-19H2/b26-20+/t25-,29+/m1/s1 |
| InChIKey | ZMKKBZVBEHYXPK-GOGOEWFZSA-N |
| XLogP | 4.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|