C20H18F2N4O2S — CID 134315732
[[2-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]amino]-[(1-methylbenzimidazol-5-yl)methoxy]methanol (PubChem CID 134315732) has the molecular formula C20H18F2N4O2S and a molecular weight of 416.45 g/mol. Its IUPAC name is [[2-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]amino]-[(1-methylbenzimidazol-5-yl)methoxy]methanol.
| Compound Name | [[2-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]amino]-[(1-methylbenzimidazol-5-yl)methoxy]methanol |
|---|---|
| PubChem CID | 134315732 |
| Molecular Formula | C20H18F2N4O2S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [[2-(2,4-difluorophenyl)-4-methyl-1,3-thiazol-5-yl]amino]-[(1-methylbenzimidazol-5-yl)methoxy]methanol |
| SMILES | Cc1nc(-c2ccc(F)cc2F)sc1NC(O)OCc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C20H18F2N4O2S/c1-11-18(29-19(24-11)14-5-4-13(21)8-15(14)22)25-20(27)28-9-12-3-6-17-16(7-12)23-10-26(17)2/h3-8,10,20,25,27H,9H2,1-2H3 |
| InChIKey | HYOWBSUECGPUGT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|