C17H14Cl2N4O3 — CID 134315879
3-(2,4-dichlorophenyl)-N'-[(2,4-dihydroxyphenyl)methyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 134315879) has the molecular formula C17H14Cl2N4O3 and a molecular weight of 393.23 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N'-[(2,4-dihydroxyphenyl)methyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(2,4-dichlorophenyl)-N'-[(2,4-dihydroxyphenyl)methyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 134315879 |
| Molecular Formula | C17H14Cl2N4O3 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N'-[(2,4-dihydroxyphenyl)methyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNCc1ccc(O)cc1O)c1cc(-c2ccc(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H14Cl2N4O3/c18-10-2-4-12(13(19)5-10)14-7-15(22-21-14)17(26)23-20-8-9-1-3-11(24)6-16(9)25/h1-7,20,24-25H,8H2,(H,21,22)(H,23,26) |
| InChIKey | LOYOQLPXSHPPGI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|