C24H19N — CID 134316394
2-(2,9-dimethylfluoranthen-3-yl)-6-methylpyridine (PubChem CID 134316394) has the molecular formula C24H19N and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(2,9-dimethylfluoranthen-3-yl)-6-methylpyridine.
| Compound Name | 2-(2,9-dimethylfluoranthen-3-yl)-6-methylpyridine |
|---|---|
| PubChem CID | 134316394 |
| Molecular Formula | C24H19N |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(2,9-dimethylfluoranthen-3-yl)-6-methylpyridine |
| SMILES | Cc1ccc2c(c1)-c1cc(C)c(-c3cccc(C)n3)c3cccc-2c13 |
| InChI | InChI=1S/C24H19N/c1-14-10-11-17-18-7-5-8-19-23(22-9-4-6-16(3)25-22)15(2)13-21(24(18)19)20(17)12-14/h4-13H,1-3H3 |
| InChIKey | PCOMNQOBKGQCJX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |