C18H22O3S — CID 134318371
4-[(2,6-dimethoxy-4-methylphenyl)-ethylsulfanylmethyl]phenol (PubChem CID 134318371) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-[(2,6-dimethoxy-4-methylphenyl)-ethylsulfanylmethyl]phenol.
| Compound Name | 4-[(2,6-dimethoxy-4-methylphenyl)-ethylsulfanylmethyl]phenol |
|---|---|
| PubChem CID | 134318371 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-[(2,6-dimethoxy-4-methylphenyl)-ethylsulfanylmethyl]phenol |
| SMILES | CCSC(c1ccc(O)cc1)c1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C18H22O3S/c1-5-22-18(13-6-8-14(19)9-7-13)17-15(20-3)10-12(2)11-16(17)21-4/h6-11,18-19H,5H2,1-4H3 |
| InChIKey | PGFZYDYQJUWOEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |