C24H24O4 — CID 123762733
4-[2-[4-[1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol (PubChem CID 123762733) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 4-[2-[4-[1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol.
| Compound Name | 4-[2-[4-[1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 123762733 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-[2-[4-[1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol |
| SMILES | COc1cc(C=Cc2ccc(O)cc2)cc(OC)c1C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H24O4/c1-16(19-8-12-21(26)13-9-19)24-22(27-2)14-18(15-23(24)28-3)5-4-17-6-10-20(25)11-7-17/h4-16,25-26H,1-3H3 |
| InChIKey | PWWRJBJHDKUYNR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|