C32H32O6 — CID 162879563
4-[2-[2-[2-(3,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol (PubChem CID 162879563) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is 4-[2-[2-[2-(3,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol.
| Compound Name | 4-[2-[2-[2-(3,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 162879563 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 4-[2-[2-[2-(3,5-dimethoxyphenyl)-1-(4-hydroxyphenyl)ethyl]-3,5-dimethoxyphenyl]ethenyl]phenol |
| SMILES | COc1cc(CC(c2ccc(O)cc2)c2c(C=Cc3ccc(O)cc3)cc(OC)cc2OC)cc(OC)c1 |
| InChI | InChI=1S/C32H32O6/c1-35-27-15-22(16-28(19-27)36-2)17-30(23-9-13-26(34)14-10-23)32-24(18-29(37-3)20-31(32)38-4)8-5-21-6-11-25(33)12-7-21/h5-16,18-20,30,33-34H,17H2,1-4H3 |
| InChIKey | DNXCPJROFURBDD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|