C30H32N2O3 — CID 134318824
3-[[4-[3-methyl-1-[5-(4-methylphenyl)indol-1-yl]butyl]benzoyl]amino]propanoic acid (PubChem CID 134318824) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[[4-[3-methyl-1-[5-(4-methylphenyl)indol-1-yl]butyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-methyl-1-[5-(4-methylphenyl)indol-1-yl]butyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134318824 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 3-[[4-[3-methyl-1-[5-(4-methylphenyl)indol-1-yl]butyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1ccc(-c2ccc3c(ccn3C(CC(C)C)c3ccc(C(=O)NCCC(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C30H32N2O3/c1-20(2)18-28(23-8-10-24(11-9-23)30(35)31-16-14-29(33)34)32-17-15-26-19-25(12-13-27(26)32)22-6-4-21(3)5-7-22/h4-13,15,17,19-20,28H,14,16,18H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | SMFKDEULQHCQFT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |