C27H48NO5P — CID 134319494
[[(4R)-4-[(5S,6R,7R,10S,13R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]methylphosphonic acid (PubChem CID 134319494) has the molecular formula C27H48NO5P and a molecular weight of 497.66 g/mol. Its IUPAC name is [[(4R)-4-[(5S,6R,7R,10S,13R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]methylphosphonic acid.
| Compound Name | [[(4R)-4-[(5S,6R,7R,10S,13R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 134319494 |
| Molecular Formula | C27H48NO5P |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | [[(4R)-4-[(5S,6R,7R,10S,13R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]methylphosphonic acid |
| SMILES | CC[C@H]1C(O)C2C3CCC([C@H](C)CCC(=O)NCP(=O)(O)O)[C@@]3(C)CCC2[C@@]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C27H48NO5P/c1-5-18-20-8-6-7-14-26(20,3)22-13-15-27(4)19(10-11-21(27)24(22)25(18)30)17(2)9-12-23(29)28-16-34(31,32)33/h17-22,24-25,30H,5-16H2,1-4H3,(H,28,29)(H2,31,32,33)/t17-,18-,19?,20+,21?,22?,24?,25?,26+,27-/m1/s1 |
| InChIKey | FFZSMZOPFUOQSD-WXXATILWSA-N |
| XLogP | 5.31 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|