C27H48N2O2 — CID 145177721
[(4R)-4-[(5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]urea (PubChem CID 145177721) has the molecular formula C27H48N2O2 and a molecular weight of 432.69 g/mol. Its IUPAC name is [(4R)-4-[(5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]urea.
| Compound Name | [(4R)-4-[(5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]urea |
|---|---|
| PubChem CID | 145177721 |
| Molecular Formula | C27H48N2O2 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.37 |
| IUPAC Name | [(4R)-4-[(5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]urea |
| SMILES | CC[C@H]1[C@@H](O)[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCCNC(N)=O)CC[C@@H]23)[C@@]2(C)CCCC[C@@H]12 |
| InChI | InChI=1S/C27H48N2O2/c1-5-18-20-10-6-7-14-26(20,3)22-13-15-27(4)19(11-12-21(27)23(22)24(18)30)17(2)9-8-16-29-25(28)31/h17-24,30H,5-16H2,1-4H3,(H3,28,29,31)/t17-,18-,19-,20+,21+,22+,23+,24-,26+,27-/m1/s1 |
| InChIKey | XPWREUUCSYRXBD-POAQADIPSA-N |
| XLogP | 5.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|