C27H20Cl2N4S — CID 134320241
methyl N-[4-(5,7-dichloro-2,3-diphenylpyrazolo[1,5-a]pyrimidin-6-yl)phenyl]ethanimidothioate (PubChem CID 134320241) has the molecular formula C27H20Cl2N4S and a molecular weight of 503.46 g/mol. Its IUPAC name is methyl N-[4-(5,7-dichloro-2,3-diphenylpyrazolo[1,5-a]pyrimidin-6-yl)phenyl]ethanimidothioate.
| Compound Name | methyl N-[4-(5,7-dichloro-2,3-diphenylpyrazolo[1,5-a]pyrimidin-6-yl)phenyl]ethanimidothioate |
|---|---|
| PubChem CID | 134320241 |
| Molecular Formula | C27H20Cl2N4S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | methyl N-[4-(5,7-dichloro-2,3-diphenylpyrazolo[1,5-a]pyrimidin-6-yl)phenyl]ethanimidothioate |
| SMILES | CS/C(C)=N/c1ccc(-c2c(Cl)nc3c(-c4ccccc4)c(-c4ccccc4)nn3c2Cl)cc1 |
| InChI | InChI=1S/C27H20Cl2N4S/c1-17(34-2)30-21-15-13-19(14-16-21)23-25(28)31-27-22(18-9-5-3-6-10-18)24(32-33(27)26(23)29)20-11-7-4-8-12-20/h3-16H,1-2H3/b30-17+ |
| InChIKey | ORIXIQYLZIHENB-OCSSWDANSA-N |
| XLogP | 8.45 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|