C31H24N2 — CID 134321263
4-(4-methyl-10-naphthalen-2-yl-3,4-dihydroanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 134321263) has the molecular formula C31H24N2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-(4-methyl-10-naphthalen-2-yl-3,4-dihydroanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(4-methyl-10-naphthalen-2-yl-3,4-dihydroanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 134321263 |
| Molecular Formula | C31H24N2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-(4-methyl-10-naphthalen-2-yl-3,4-dihydroanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(c2c3c(c(-c4ccc5ccccc5c4)c4ccccc24)C(C)CC=C3)C=C/C1=N\[H] |
| InChI | InChI=1S/C31H24N2/c1-19-7-6-12-26-29(19)31(22-14-13-20-8-2-3-9-21(20)17-22)25-11-5-4-10-24(25)30(26)23-15-16-27(32)28(33)18-23/h2-6,8-19,32-33H,7H2,1H3/b32-27+,33-28- |
| InChIKey | UMKCATBOOYPQQT-QPNRKFHMSA-N |
| XLogP | 8.17 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|