C27H48FN7O2 — CID 134321511
3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]piperidin-3-yl]-2-(6-butyl-3-fluoro-1-azabicyclo[4.2.1]nonan-8-yl)propanamide (PubChem CID 134321511) has the molecular formula C27H48FN7O2 and a molecular weight of 521.73 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]piperidin-3-yl]-2-(6-butyl-3-fluoro-1-azabicyclo[4.2.1]nonan-8-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]piperidin-3-yl]-2-(6-butyl-3-fluoro-1-azabicyclo[4.2.1]nonan-8-yl)propanamide |
|---|---|
| PubChem CID | 134321511 |
| Molecular Formula | C27H48FN7O2 |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]piperidin-3-yl]-2-(6-butyl-3-fluoro-1-azabicyclo[4.2.1]nonan-8-yl)propanamide |
| SMILES | CCCCC12CCC(F)CN(C1)C(C(C(=O)NC1CNCCC1N1CCN3C(=O)CC[C@@H]3C1)C(N)N)C2 |
| InChI | InChI=1S/C27H48FN7O2/c1-2-3-8-27-9-6-18(28)15-34(17-27)22(13-27)24(25(29)30)26(37)32-20-14-31-10-7-21(20)33-11-12-35-19(16-33)4-5-23(35)36/h18-22,24-25,31H,2-17,29-30H2,1H3,(H,32,37)/t18?,19-,20?,21?,22?,24?,27?/m1/s1 |
| InChIKey | YMDOFIRQKCVGDQ-JFNRMQHWSA-N |
| XLogP | 0.38 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|